C23H28O8 — CID 15819303
[(5R,6R,7S,8R)-6-(hydroxymethyl)-5-methoxy-8-(3,4,5-trimethoxyphenyl)-5,6,7,8-tetrahydrobenzo[f][1,3]benzodioxol-7-yl]methanol (PubChem CID 15819303) has the molecular formula C23H28O8 and a molecular weight of 432.47 g/mol. Its IUPAC name is [(5R,6R,7S,8R)-6-(hydroxymethyl)-5-methoxy-8-(3,4,5-trimethoxyphenyl)-5,6,7,8-tetrahydrobenzo[f][1,3]benzodioxol-7-yl]methanol.
| Compound Name | [(5R,6R,7S,8R)-6-(hydroxymethyl)-5-methoxy-8-(3,4,5-trimethoxyphenyl)-5,6,7,8-tetrahydrobenzo[f][1,3]benzodioxol-7-yl]methanol |
|---|---|
| PubChem CID | 15819303 |
| Molecular Formula | C23H28O8 |
| Molecular Weight | 432.47 g/mol |
| Exact Mass | 432.18 |
| IUPAC Name | [(5R,6R,7S,8R)-6-(hydroxymethyl)-5-methoxy-8-(3,4,5-trimethoxyphenyl)-5,6,7,8-tetrahydrobenzo[f][1,3]benzodioxol-7-yl]methanol |
| SMILES | COc1cc([C@@H]2c3cc4c(cc3[C@H](OC)[C@@H](CO)[C@H]2CO)OCO4)cc(OC)c1OC |
| InChI | InChI=1S/C23H28O8/c1-26-19-5-12(6-20(27-2)23(19)29-4)21-13-7-17-18(31-11-30-17)8-14(13)22(28-3)16(10-25)15(21)9-24/h5-8,15-16,21-22,24-25H,9-11H2,1-4H3/t15-,16+,21-,22+/m1/s1 |
| InChIKey | HFJUEMBDVJWNHU-ZXJYCPGTSA-N |
| XLogP | 2.49 |
| TPSA | 95.84 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 432.47 |
| LogP ≤ 5 | 2.49 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |