C20H22O7 — CID 11909232
(6S,7S,8S)-7-methyl-8-(3,4,5-trimethoxyphenyl)-7,8-dihydro-6H-[1,3]dioxolo[4,5-g]chromen-6-ol (PubChem CID 11909232) has the molecular formula C20H22O7 and a molecular weight of 374.39 g/mol. Its IUPAC name is (6S,7S,8S)-7-methyl-8-(3,4,5-trimethoxyphenyl)-7,8-dihydro-6H-[1,3]dioxolo[4,5-g]chromen-6-ol.
| Compound Name | (6S,7S,8S)-7-methyl-8-(3,4,5-trimethoxyphenyl)-7,8-dihydro-6H-[1,3]dioxolo[4,5-g]chromen-6-ol |
|---|---|
| PubChem CID | 11909232 |
| Molecular Formula | C20H22O7 |
| Molecular Weight | 374.39 g/mol |
| Exact Mass | 374.14 |
| IUPAC Name | (6S,7S,8S)-7-methyl-8-(3,4,5-trimethoxyphenyl)-7,8-dihydro-6H-[1,3]dioxolo[4,5-g]chromen-6-ol |
| SMILES | COc1cc([C@H]2c3cc4c(cc3O[C@H](O)[C@H]2C)OCO4)cc(OC)c1OC |
| InChI | InChI=1S/C20H22O7/c1-10-18(11-5-16(22-2)19(24-4)17(6-11)23-3)12-7-14-15(26-9-25-14)8-13(12)27-20(10)21/h5-8,10,18,20-21H,9H2,1-4H3/t10-,18-,20-/m0/s1 |
| InChIKey | RBDOZECECGJHSC-RHSNALOTSA-N |
| XLogP | 2.92 |
| TPSA | 75.61 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 374.39 |
| LogP ≤ 5 | 2.92 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |