C24H29NO7 — CID 92852148
4-[(6S,7R,8S)-7-methyl-8-(3,4,5-trimethoxyphenyl)-7,8-dihydro-6H-[1,3]dioxolo[4,5-g]chromen-6-yl]morpholine (PubChem CID 92852148) has the molecular formula C24H29NO7 and a molecular weight of 443.50 g/mol. Its IUPAC name is 4-[(6S,7R,8S)-7-methyl-8-(3,4,5-trimethoxyphenyl)-7,8-dihydro-6H-[1,3]dioxolo[4,5-g]chromen-6-yl]morpholine.
| Compound Name | 4-[(6S,7R,8S)-7-methyl-8-(3,4,5-trimethoxyphenyl)-7,8-dihydro-6H-[1,3]dioxolo[4,5-g]chromen-6-yl]morpholine |
|---|---|
| PubChem CID | 92852148 |
| Molecular Formula | C24H29NO7 |
| Molecular Weight | 443.50 g/mol |
| Exact Mass | 443.19 |
| IUPAC Name | 4-[(6S,7R,8S)-7-methyl-8-(3,4,5-trimethoxyphenyl)-7,8-dihydro-6H-[1,3]dioxolo[4,5-g]chromen-6-yl]morpholine |
| SMILES | COc1cc([C@H]2c3cc4c(cc3O[C@H](N3CCOCC3)[C@@H]2C)OCO4)cc(OC)c1OC |
| InChI | InChI=1S/C24H29NO7/c1-14-22(15-9-20(26-2)23(28-4)21(10-15)27-3)16-11-18-19(31-13-30-18)12-17(16)32-24(14)25-5-7-29-8-6-25/h9-12,14,22,24H,5-8,13H2,1-4H3/t14-,22+,24+/m1/s1 |
| InChIKey | NIAGVHRQRDGPQR-QQFWFLOESA-N |
| XLogP | 3.26 |
| TPSA | 67.85 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 443.50 |
| LogP ≤ 5 | 3.26 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |