C22H23NO6 — CID 10620812
4-[(6R,7R,8S)-8-(1,3-benzodioxol-5-yl)-7-methyl-7,8-dihydro-6H-[1,3]dioxolo[4,5-g]chromen-6-yl]morpholine (PubChem CID 10620812) has the molecular formula C22H23NO6 and a molecular weight of 397.43 g/mol. Its IUPAC name is 4-[(6R,7R,8S)-8-(1,3-benzodioxol-5-yl)-7-methyl-7,8-dihydro-6H-[1,3]dioxolo[4,5-g]chromen-6-yl]morpholine.
| Compound Name | 4-[(6R,7R,8S)-8-(1,3-benzodioxol-5-yl)-7-methyl-7,8-dihydro-6H-[1,3]dioxolo[4,5-g]chromen-6-yl]morpholine |
|---|---|
| PubChem CID | 10620812 |
| Molecular Formula | C22H23NO6 |
| Molecular Weight | 397.43 g/mol |
| Exact Mass | 397.15 |
| IUPAC Name | 4-[(6R,7R,8S)-8-(1,3-benzodioxol-5-yl)-7-methyl-7,8-dihydro-6H-[1,3]dioxolo[4,5-g]chromen-6-yl]morpholine |
| SMILES | C[C@@H]1[C@@H](c2ccc3c(c2)OCO3)c2cc3c(cc2O[C@H]1N1CCOCC1)OCO3 |
| InChI | InChI=1S/C22H23NO6/c1-13-21(14-2-3-16-18(8-14)26-11-25-16)15-9-19-20(28-12-27-19)10-17(15)29-22(13)23-4-6-24-7-5-23/h2-3,8-10,13,21-22H,4-7,11-12H2,1H3/t13-,21+,22-/m1/s1 |
| InChIKey | OFUMSTVCETVCLF-BGUDKVOASA-N |
| XLogP | 2.96 |
| TPSA | 58.62 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 397.43 |
| LogP ≤ 5 | 2.96 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |