C17H23NO4 — CID 56722210
(3S,4S)-4-(1,3-benzodioxol-5-yl)-1-(oxan-4-yl)piperidin-3-ol (PubChem CID 56722210) has the molecular formula C17H23NO4 and a molecular weight of 305.37 g/mol. Its IUPAC name is (3S,4S)-4-(1,3-benzodioxol-5-yl)-1-(oxan-4-yl)piperidin-3-ol.
| Compound Name | (3S,4S)-4-(1,3-benzodioxol-5-yl)-1-(oxan-4-yl)piperidin-3-ol |
|---|---|
| PubChem CID | 56722210 |
| Molecular Formula | C17H23NO4 |
| Molecular Weight | 305.37 g/mol |
| Exact Mass | 305.16 |
| IUPAC Name | (3S,4S)-4-(1,3-benzodioxol-5-yl)-1-(oxan-4-yl)piperidin-3-ol |
| SMILES | O[C@@H]1CN(C2CCOCC2)CC[C@H]1c1ccc2c(c1)OCO2 |
| InChI | InChI=1S/C17H23NO4/c19-15-10-18(13-4-7-20-8-5-13)6-3-14(15)12-1-2-16-17(9-12)22-11-21-16/h1-2,9,13-15,19H,3-8,10-11H2/t14-,15+/m0/s1 |
| InChIKey | JDIIUSVIVAAZBT-LSDHHAIUSA-N |
| XLogP | 1.74 |
| TPSA | 51.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 305.37 |
| LogP ≤ 5 | 1.74 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |