C18H17NO6 — CID 50983950
1-[(3S,4S)-4-(1,3-benzodioxol-5-yl)-3-hydroxypiperidin-1-yl]-2-(furan-2-yl)ethane-1,2-dione (PubChem CID 50983950) has the molecular formula C18H17NO6 and a molecular weight of 343.34 g/mol. Its IUPAC name is 1-[(3S,4S)-4-(1,3-benzodioxol-5-yl)-3-hydroxypiperidin-1-yl]-2-(furan-2-yl)ethane-1,2-dione.
| Compound Name | 1-[(3S,4S)-4-(1,3-benzodioxol-5-yl)-3-hydroxypiperidin-1-yl]-2-(furan-2-yl)ethane-1,2-dione |
|---|---|
| PubChem CID | 50983950 |
| Molecular Formula | C18H17NO6 |
| Molecular Weight | 343.34 g/mol |
| Exact Mass | 343.11 |
| IUPAC Name | 1-[(3S,4S)-4-(1,3-benzodioxol-5-yl)-3-hydroxypiperidin-1-yl]-2-(furan-2-yl)ethane-1,2-dione |
| SMILES | O=C(C(=O)N1CC[C@@H](c2ccc3c(c2)OCO3)[C@H](O)C1)c1ccco1 |
| InChI | InChI=1S/C18H17NO6/c20-13-9-19(18(22)17(21)15-2-1-7-23-15)6-5-12(13)11-3-4-14-16(8-11)25-10-24-14/h1-4,7-8,12-13,20H,5-6,9-10H2/t12-,13+/m0/s1 |
| InChIKey | VLYWBHIGZCEFID-QWHCGFSZSA-N |
| XLogP | 1.57 |
| TPSA | 89.21 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 343.34 |
| LogP ≤ 5 | 1.57 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|