C18H18ClN3O4 — CID 50965232
(3S,4S)-4-(1,3-benzodioxol-5-yl)-N-(6-chloro-3-pyridinyl)-3-hydroxypiperidine-1-carboxamide (PubChem CID 50965232) has the molecular formula C18H18ClN3O4 and a molecular weight of 375.81 g/mol. Its IUPAC name is (3S,4S)-4-(1,3-benzodioxol-5-yl)-N-(6-chloro-3-pyridinyl)-3-hydroxypiperidine-1-carboxamide.
| Compound Name | (3S,4S)-4-(1,3-benzodioxol-5-yl)-N-(6-chloro-3-pyridinyl)-3-hydroxypiperidine-1-carboxamide |
|---|---|
| PubChem CID | 50965232 |
| Molecular Formula | C18H18ClN3O4 |
| Molecular Weight | 375.81 g/mol |
| Exact Mass | 375.10 |
| IUPAC Name | (3S,4S)-4-(1,3-benzodioxol-5-yl)-N-(6-chloro-3-pyridinyl)-3-hydroxypiperidine-1-carboxamide |
| SMILES | O=C(Nc1ccc(Cl)nc1)N1CC[C@@H](c2ccc3c(c2)OCO3)[C@H](O)C1 |
| InChI | InChI=1S/C18H18ClN3O4/c19-17-4-2-12(8-20-17)21-18(24)22-6-5-13(14(23)9-22)11-1-3-15-16(7-11)26-10-25-15/h1-4,7-8,13-14,23H,5-6,9-10H2,(H,21,24)/t13-,14+/m0/s1 |
| InChIKey | MLVDETXXFXHDRS-UONOGXRCSA-N |
| XLogP | 2.85 |
| TPSA | 83.92 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 375.81 |
| LogP ≤ 5 | 2.85 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|