C17H19N3O6 — CID 56713225
3-[2-[(3S,4S)-4-(1,3-benzodioxol-5-yl)-3-hydroxypiperidin-1-yl]-2-oxoethyl]imidazolidine-2,4-dione (PubChem CID 56713225) has the molecular formula C17H19N3O6 and a molecular weight of 361.35 g/mol. Its IUPAC name is 3-[2-[(3S,4S)-4-(1,3-benzodioxol-5-yl)-3-hydroxypiperidin-1-yl]-2-oxoethyl]imidazolidine-2,4-dione.
| Compound Name | 3-[2-[(3S,4S)-4-(1,3-benzodioxol-5-yl)-3-hydroxypiperidin-1-yl]-2-oxoethyl]imidazolidine-2,4-dione |
|---|---|
| PubChem CID | 56713225 |
| Molecular Formula | C17H19N3O6 |
| Molecular Weight | 361.35 g/mol |
| Exact Mass | 361.13 |
| IUPAC Name | 3-[2-[(3S,4S)-4-(1,3-benzodioxol-5-yl)-3-hydroxypiperidin-1-yl]-2-oxoethyl]imidazolidine-2,4-dione |
| SMILES | O=C(CN1C(=O)CNC1=O)N1CC[C@@H](c2ccc3c(c2)OCO3)[C@H](O)C1 |
| InChI | InChI=1S/C17H19N3O6/c21-12-7-19(16(23)8-20-15(22)6-18-17(20)24)4-3-11(12)10-1-2-13-14(5-10)26-9-25-13/h1-2,5,11-12,21H,3-4,6-9H2,(H,18,24)/t11-,12+/m0/s1 |
| InChIKey | JYHHATMOLDRMCF-NWDGAFQWSA-N |
| XLogP | -0.36 |
| TPSA | 108.41 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 361.35 |
| LogP ≤ 5 | -0.36 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|