C19H26N2O4 — CID 91812988
N-[[1-(oxan-4-yl)piperidin-4-yl]methyl]-1,3-benzodioxole-5-carboxamide (PubChem CID 91812988) has the molecular formula C19H26N2O4 and a molecular weight of 346.43 g/mol. Its IUPAC name is N-[[1-(oxan-4-yl)piperidin-4-yl]methyl]-1,3-benzodioxole-5-carboxamide.
| Compound Name | N-[[1-(oxan-4-yl)piperidin-4-yl]methyl]-1,3-benzodioxole-5-carboxamide |
|---|---|
| PubChem CID | 91812988 |
| Molecular Formula | C19H26N2O4 |
| Molecular Weight | 346.43 g/mol |
| Exact Mass | 346.19 |
| IUPAC Name | N-[[1-(oxan-4-yl)piperidin-4-yl]methyl]-1,3-benzodioxole-5-carboxamide |
| SMILES | O=C(NCC1CCN(C2CCOCC2)CC1)c1ccc2c(c1)OCO2 |
| InChI | InChI=1S/C19H26N2O4/c22-19(15-1-2-17-18(11-15)25-13-24-17)20-12-14-3-7-21(8-4-14)16-5-9-23-10-6-16/h1-2,11,14,16H,3-10,12-13H2,(H,20,22) |
| InChIKey | IKAZNMRAWRPYHB-UHFFFAOYSA-N |
| XLogP | 2.04 |
| TPSA | 60.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 346.43 |
| LogP ≤ 5 | 2.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |