C16H20BrNO3 — CID 114317356
N-[[2-(bromomethyl)cyclohexyl]methyl]-1,3-benzodioxole-5-carboxamide (PubChem CID 114317356) has the molecular formula C16H20BrNO3 and a molecular weight of 354.24 g/mol. Its IUPAC name is N-[[2-(bromomethyl)cyclohexyl]methyl]-1,3-benzodioxole-5-carboxamide.
| Compound Name | N-[[2-(bromomethyl)cyclohexyl]methyl]-1,3-benzodioxole-5-carboxamide |
|---|---|
| PubChem CID | 114317356 |
| Molecular Formula | C16H20BrNO3 |
| Molecular Weight | 354.24 g/mol |
| Exact Mass | 353.06 |
| IUPAC Name | N-[[2-(bromomethyl)cyclohexyl]methyl]-1,3-benzodioxole-5-carboxamide |
| SMILES | O=C(NCC1CCCCC1CBr)c1ccc2c(c1)OCO2 |
| InChI | InChI=1S/C16H20BrNO3/c17-8-12-3-1-2-4-13(12)9-18-16(19)11-5-6-14-15(7-11)21-10-20-14/h5-7,12-13H,1-4,8-10H2,(H,18,19) |
| InChIKey | SDVMRRZLLAKXHR-UHFFFAOYSA-N |
| XLogP | 3.35 |
| TPSA | 47.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 354.24 |
| LogP ≤ 5 | 3.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|