C17H25BrN2O — CID 114317430
N-[[2-(bromomethyl)cyclohexyl]methyl]-3-(dimethylamino)benzamide (PubChem CID 114317430) has the molecular formula C17H25BrN2O and a molecular weight of 353.30 g/mol. Its IUPAC name is N-[[2-(bromomethyl)cyclohexyl]methyl]-3-(dimethylamino)benzamide.
| Compound Name | N-[[2-(bromomethyl)cyclohexyl]methyl]-3-(dimethylamino)benzamide |
|---|---|
| PubChem CID | 114317430 |
| Molecular Formula | C17H25BrN2O |
| Molecular Weight | 353.30 g/mol |
| Exact Mass | 352.12 |
| IUPAC Name | N-[[2-(bromomethyl)cyclohexyl]methyl]-3-(dimethylamino)benzamide |
| SMILES | CN(C)c1cccc(C(=O)NCC2CCCCC2CBr)c1 |
| InChI | InChI=1S/C17H25BrN2O/c1-20(2)16-9-5-8-13(10-16)17(21)19-12-15-7-4-3-6-14(15)11-18/h5,8-10,14-15H,3-4,6-7,11-12H2,1-2H3,(H,19,21) |
| InChIKey | JWUJSLPQRVCRSP-UHFFFAOYSA-N |
| XLogP | 3.68 |
| TPSA | 32.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 353.30 |
| LogP ≤ 5 | 3.68 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|