C17H23NO3S2 — CID 56715267
(3S,4S)-4-(1,3-benzodioxol-5-yl)-1-(1,4-dithiepan-6-yl)piperidin-3-ol (PubChem CID 56715267) has the molecular formula C17H23NO3S2 and a molecular weight of 353.51 g/mol. Its IUPAC name is (3S,4S)-4-(1,3-benzodioxol-5-yl)-1-(1,4-dithiepan-6-yl)piperidin-3-ol.
| Compound Name | (3S,4S)-4-(1,3-benzodioxol-5-yl)-1-(1,4-dithiepan-6-yl)piperidin-3-ol |
|---|---|
| PubChem CID | 56715267 |
| Molecular Formula | C17H23NO3S2 |
| Molecular Weight | 353.51 g/mol |
| Exact Mass | 353.11 |
| IUPAC Name | (3S,4S)-4-(1,3-benzodioxol-5-yl)-1-(1,4-dithiepan-6-yl)piperidin-3-ol |
| SMILES | O[C@@H]1CN(C2CSCCSC2)CC[C@H]1c1ccc2c(c1)OCO2 |
| InChI | InChI=1S/C17H23NO3S2/c19-15-8-18(13-9-22-5-6-23-10-13)4-3-14(15)12-1-2-16-17(7-12)21-11-20-16/h1-2,7,13-15,19H,3-6,8-11H2/t14-,15+/m0/s1 |
| InChIKey | PEJVWXQGMFVERQ-LSDHHAIUSA-N |
| XLogP | 2.41 |
| TPSA | 41.93 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 353.51 |
| LogP ≤ 5 | 2.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |