C22H24O7 — CID 11894211
(3S,7R,8R)-8-(3,4,5-trimethoxyphenyl)-2,12,14-trioxatetracyclo[7.7.0.03,7.011,15]hexadeca-1(16),9,11(15)-trien-3-ol (PubChem CID 11894211) has the molecular formula C22H24O7 and a molecular weight of 400.43 g/mol. Its IUPAC name is (3S,7R,8R)-8-(3,4,5-trimethoxyphenyl)-2,12,14-trioxatetracyclo[7.7.0.03,7.011,15]hexadeca-1(16),9,11(15)-trien-3-ol.
| Compound Name | (3S,7R,8R)-8-(3,4,5-trimethoxyphenyl)-2,12,14-trioxatetracyclo[7.7.0.03,7.011,15]hexadeca-1(16),9,11(15)-trien-3-ol |
|---|---|
| PubChem CID | 11894211 |
| Molecular Formula | C22H24O7 |
| Molecular Weight | 400.43 g/mol |
| Exact Mass | 400.15 |
| IUPAC Name | (3S,7R,8R)-8-(3,4,5-trimethoxyphenyl)-2,12,14-trioxatetracyclo[7.7.0.03,7.011,15]hexadeca-1(16),9,11(15)-trien-3-ol |
| SMILES | COc1cc([C@@H]2c3cc4c(cc3O[C@@]3(O)CCC[C@H]23)OCO4)cc(OC)c1OC |
| InChI | InChI=1S/C22H24O7/c1-24-18-7-12(8-19(25-2)21(18)26-3)20-13-9-16-17(28-11-27-16)10-15(13)29-22(23)6-4-5-14(20)22/h7-10,14,20,23H,4-6,11H2,1-3H3/t14-,20-,22+/m1/s1 |
| InChIKey | CWOWDHSRSSJSHJ-ZFGLAFRWSA-N |
| XLogP | 3.45 |
| TPSA | 75.61 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 400.43 |
| LogP ≤ 5 | 3.45 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |