C21H24O7 — CID 153315870
(6S,7S,8S)-6,7-dimethyl-8-(2,3,4-trimethoxyphenyl)-7,8-dihydro-[1,3]dioxolo[4,5-g]chromen-6-ol (PubChem CID 153315870) has the molecular formula C21H24O7 and a molecular weight of 388.42 g/mol. Its IUPAC name is (6S,7S,8S)-6,7-dimethyl-8-(2,3,4-trimethoxyphenyl)-7,8-dihydro-[1,3]dioxolo[4,5-g]chromen-6-ol.
| Compound Name | (6S,7S,8S)-6,7-dimethyl-8-(2,3,4-trimethoxyphenyl)-7,8-dihydro-[1,3]dioxolo[4,5-g]chromen-6-ol |
|---|---|
| PubChem CID | 153315870 |
| Molecular Formula | C21H24O7 |
| Molecular Weight | 388.42 g/mol |
| Exact Mass | 388.15 |
| IUPAC Name | (6S,7S,8S)-6,7-dimethyl-8-(2,3,4-trimethoxyphenyl)-7,8-dihydro-[1,3]dioxolo[4,5-g]chromen-6-ol |
| SMILES | COc1ccc([C@@H]2c3cc4c(cc3O[C@](C)(O)[C@H]2C)OCO4)c(OC)c1OC |
| InChI | InChI=1S/C21H24O7/c1-11-18(12-6-7-14(23-3)20(25-5)19(12)24-4)13-8-16-17(27-10-26-16)9-15(13)28-21(11,2)22/h6-9,11,18,22H,10H2,1-5H3/t11-,18+,21-/m0/s1 |
| InChIKey | RFJNGGPROOMCLU-ZHXKBUHHSA-N |
| XLogP | 3.31 |
| TPSA | 75.61 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 388.42 |
| LogP ≤ 5 | 3.31 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |