C19H20O6 — CID 7601831
(6R,7R,8S)-8-(2-hydroxy-3-methoxyphenyl)-6,7-dimethyl-7,8-dihydro-[1,3]dioxolo[4,5-g]chromen-6-ol (PubChem CID 7601831) has the molecular formula C19H20O6 and a molecular weight of 344.36 g/mol. Its IUPAC name is (6R,7R,8S)-8-(2-hydroxy-3-methoxyphenyl)-6,7-dimethyl-7,8-dihydro-[1,3]dioxolo[4,5-g]chromen-6-ol.
| Compound Name | (6R,7R,8S)-8-(2-hydroxy-3-methoxyphenyl)-6,7-dimethyl-7,8-dihydro-[1,3]dioxolo[4,5-g]chromen-6-ol |
|---|---|
| PubChem CID | 7601831 |
| Molecular Formula | C19H20O6 |
| Molecular Weight | 344.36 g/mol |
| Exact Mass | 344.13 |
| IUPAC Name | (6R,7R,8S)-8-(2-hydroxy-3-methoxyphenyl)-6,7-dimethyl-7,8-dihydro-[1,3]dioxolo[4,5-g]chromen-6-ol |
| SMILES | COc1cccc([C@H]2c3cc4c(cc3O[C@@](C)(O)[C@@H]2C)OCO4)c1O |
| InChI | InChI=1S/C19H20O6/c1-10-17(11-5-4-6-13(22-3)18(11)20)12-7-15-16(24-9-23-15)8-14(12)25-19(10,2)21/h4-8,10,17,20-21H,9H2,1-3H3/t10-,17+,19-/m1/s1 |
| InChIKey | XVACPSXAAOKKMX-XVWMFJGMSA-N |
| XLogP | 3.00 |
| TPSA | 77.38 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 344.36 |
| LogP ≤ 5 | 3.00 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |