C23H27NO5 — CID 95906994
2-[(6S,7R,8R)-7-ethyl-6-pyrrolidin-1-yl-7,8-dihydro-6H-[1,3]dioxolo[4,5-g]chromen-8-yl]-6-methoxyphenol (PubChem CID 95906994) has the molecular formula C23H27NO5 and a molecular weight of 397.47 g/mol. Its IUPAC name is 2-[(6S,7R,8R)-7-ethyl-6-pyrrolidin-1-yl-7,8-dihydro-6H-[1,3]dioxolo[4,5-g]chromen-8-yl]-6-methoxyphenol.
| Compound Name | 2-[(6S,7R,8R)-7-ethyl-6-pyrrolidin-1-yl-7,8-dihydro-6H-[1,3]dioxolo[4,5-g]chromen-8-yl]-6-methoxyphenol |
|---|---|
| PubChem CID | 95906994 |
| Molecular Formula | C23H27NO5 |
| Molecular Weight | 397.47 g/mol |
| Exact Mass | 397.19 |
| IUPAC Name | 2-[(6S,7R,8R)-7-ethyl-6-pyrrolidin-1-yl-7,8-dihydro-6H-[1,3]dioxolo[4,5-g]chromen-8-yl]-6-methoxyphenol |
| SMILES | CC[C@@H]1[C@H](c2cccc(OC)c2O)c2cc3c(cc2O[C@@H]1N1CCCC1)OCO3 |
| InChI | InChI=1S/C23H27NO5/c1-3-14-21(15-7-6-8-17(26-2)22(15)25)16-11-19-20(28-13-27-19)12-18(16)29-23(14)24-9-4-5-10-24/h6-8,11-12,14,21,23,25H,3-5,9-10,13H2,1-2H3/t14-,21-,23+/m1/s1 |
| InChIKey | UWMPNVWZHCIJMI-NZCIYTFRSA-N |
| XLogP | 4.10 |
| TPSA | 60.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 397.47 |
| LogP ≤ 5 | 4.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |