C23H29NO6 — CID 94904290
4-[(6S,7R,8R)-6-(diethylamino)-7-methyl-7,8-dihydro-6H-[1,3]dioxolo[4,5-g]chromen-8-yl]-2,6-dimethoxyphenol (PubChem CID 94904290) has the molecular formula C23H29NO6 and a molecular weight of 415.49 g/mol. Its IUPAC name is 4-[(6S,7R,8R)-6-(diethylamino)-7-methyl-7,8-dihydro-6H-[1,3]dioxolo[4,5-g]chromen-8-yl]-2,6-dimethoxyphenol.
| Compound Name | 4-[(6S,7R,8R)-6-(diethylamino)-7-methyl-7,8-dihydro-6H-[1,3]dioxolo[4,5-g]chromen-8-yl]-2,6-dimethoxyphenol |
|---|---|
| PubChem CID | 94904290 |
| Molecular Formula | C23H29NO6 |
| Molecular Weight | 415.49 g/mol |
| Exact Mass | 415.20 |
| IUPAC Name | 4-[(6S,7R,8R)-6-(diethylamino)-7-methyl-7,8-dihydro-6H-[1,3]dioxolo[4,5-g]chromen-8-yl]-2,6-dimethoxyphenol |
| SMILES | CCN(CC)[C@H]1Oc2cc3c(cc2[C@@H](c2cc(OC)c(O)c(OC)c2)[C@H]1C)OCO3 |
| InChI | InChI=1S/C23H29NO6/c1-6-24(7-2)23-13(3)21(14-8-19(26-4)22(25)20(9-14)27-5)15-10-17-18(29-12-28-17)11-16(15)30-23/h8-11,13,21,23,25H,6-7,12H2,1-5H3/t13-,21-,23+/m1/s1 |
| InChIKey | OMMBEWHNDYJBLZ-ZGWOSQSPSA-N |
| XLogP | 3.97 |
| TPSA | 69.62 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 415.49 |
| LogP ≤ 5 | 3.97 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |