C22H27NO7 — CID 95907665
2-[[(6S,7S,8S)-7-methyl-8-(3,4,5-trimethoxyphenyl)-7,8-dihydro-6H-[1,3]dioxolo[4,5-g]chromen-6-yl]amino]ethanol (PubChem CID 95907665) has the molecular formula C22H27NO7 and a molecular weight of 417.46 g/mol. Its IUPAC name is 2-[[(6S,7S,8S)-7-methyl-8-(3,4,5-trimethoxyphenyl)-7,8-dihydro-6H-[1,3]dioxolo[4,5-g]chromen-6-yl]amino]ethanol.
| Compound Name | 2-[[(6S,7S,8S)-7-methyl-8-(3,4,5-trimethoxyphenyl)-7,8-dihydro-6H-[1,3]dioxolo[4,5-g]chromen-6-yl]amino]ethanol |
|---|---|
| PubChem CID | 95907665 |
| Molecular Formula | C22H27NO7 |
| Molecular Weight | 417.46 g/mol |
| Exact Mass | 417.18 |
| IUPAC Name | 2-[[(6S,7S,8S)-7-methyl-8-(3,4,5-trimethoxyphenyl)-7,8-dihydro-6H-[1,3]dioxolo[4,5-g]chromen-6-yl]amino]ethanol |
| SMILES | COc1cc([C@H]2c3cc4c(cc3O[C@H](NCCO)[C@H]2C)OCO4)cc(OC)c1OC |
| InChI | InChI=1S/C22H27NO7/c1-12-20(13-7-18(25-2)21(27-4)19(8-13)26-3)14-9-16-17(29-11-28-16)10-15(14)30-22(12)23-5-6-24/h7-10,12,20,22-24H,5-6,11H2,1-4H3/t12-,20-,22-/m0/s1 |
| InChIKey | CHLPTPUGQIRMDQ-APKAMQJDSA-N |
| XLogP | 2.51 |
| TPSA | 87.64 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 417.46 |
| LogP ≤ 5 | 2.51 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |