C23H26O7 — CID 11924116
(5aS,9aR,10S)-10-(3,4,5-trimethoxyphenyl)-6,7,8,9,9a,10-hexahydro-[1,3]dioxolo[4,5-b]xanthen-5a-ol (PubChem CID 11924116) has the molecular formula C23H26O7 and a molecular weight of 414.45 g/mol. Its IUPAC name is (5aS,9aR,10S)-10-(3,4,5-trimethoxyphenyl)-6,7,8,9,9a,10-hexahydro-[1,3]dioxolo[4,5-b]xanthen-5a-ol.
| Compound Name | (5aS,9aR,10S)-10-(3,4,5-trimethoxyphenyl)-6,7,8,9,9a,10-hexahydro-[1,3]dioxolo[4,5-b]xanthen-5a-ol |
|---|---|
| PubChem CID | 11924116 |
| Molecular Formula | C23H26O7 |
| Molecular Weight | 414.45 g/mol |
| Exact Mass | 414.17 |
| IUPAC Name | (5aS,9aR,10S)-10-(3,4,5-trimethoxyphenyl)-6,7,8,9,9a,10-hexahydro-[1,3]dioxolo[4,5-b]xanthen-5a-ol |
| SMILES | COc1cc([C@H]2c3cc4c(cc3O[C@@]3(O)CCCC[C@H]23)OCO4)cc(OC)c1OC |
| InChI | InChI=1S/C23H26O7/c1-25-19-8-13(9-20(26-2)22(19)27-3)21-14-10-17-18(29-12-28-17)11-16(14)30-23(24)7-5-4-6-15(21)23/h8-11,15,21,24H,4-7,12H2,1-3H3/t15-,21+,23+/m1/s1 |
| InChIKey | JSXFDFZXOXEPLF-XFEVJDRUSA-N |
| XLogP | 3.84 |
| TPSA | 75.61 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 414.45 |
| LogP ≤ 5 | 3.84 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |