C33H52O8Si2 — CID 11365662
[(5R,6S,7S,8R)-5-[tert-butyl(dimethyl)silyl]oxy-8-[4-[tert-butyl(dimethyl)silyl]oxy-3,5-dimethoxyphenyl]-6-(hydroxymethyl)-5,6,7,8-tetrahydrobenzo[f][1,3]benzodioxol-7-yl]methanol (PubChem CID 11365662) has the molecular formula C33H52O8Si2 and a molecular weight of 632.94 g/mol. Its IUPAC name is [(5R,6S,7S,8R)-5-[tert-butyl(dimethyl)silyl]oxy-8-[4-[tert-butyl(dimethyl)silyl]oxy-3,5-dimethoxyphenyl]-6-(hydroxymethyl)-5,6,7,8-tetrahydrobenzo[f][1,3]benzodioxol-7-yl]methanol.
| Compound Name | [(5R,6S,7S,8R)-5-[tert-butyl(dimethyl)silyl]oxy-8-[4-[tert-butyl(dimethyl)silyl]oxy-3,5-dimethoxyphenyl]-6-(hydroxymethyl)-5,6,7,8-tetrahydrobenzo[f][1,3]benzodioxol-7-yl]methanol |
|---|---|
| PubChem CID | 11365662 |
| Molecular Formula | C33H52O8Si2 |
| Molecular Weight | 632.94 g/mol |
| Exact Mass | 632.32 |
| IUPAC Name | [(5R,6S,7S,8R)-5-[tert-butyl(dimethyl)silyl]oxy-8-[4-[tert-butyl(dimethyl)silyl]oxy-3,5-dimethoxyphenyl]-6-(hydroxymethyl)-5,6,7,8-tetrahydrobenzo[f][1,3]benzodioxol-7-yl]methanol |
| SMILES | COc1cc([C@@H]2c3cc4c(cc3[C@H](O[Si](C)(C)C(C)(C)C)[C@H](CO)[C@H]2CO)OCO4)cc(OC)c1O[Si](C)(C)C(C)(C)C |
| InChI | InChI=1S/C33H52O8Si2/c1-32(2,3)42(9,10)40-30-22-16-26-25(38-19-39-26)15-21(22)29(23(17-34)24(30)18-35)20-13-27(36-7)31(28(14-20)37-8)41-43(11,12)33(4,5)6/h13-16,23-24,29-30,34-35H,17-19H2,1-12H3/t23-,24-,29-,30+/m1/s1 |
| InChIKey | CNZHBSZUIFCSDO-IPMXHECSSA-N |
| XLogP | 7.24 |
| TPSA | 95.84 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 632.94 |
| LogP ≤ 5 | 7.24 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|