C27H38O5Si — CID 53474899
[(1R,2R,3S,4R)-4-(1,3-benzodioxol-5-yl)-6,7-dimethoxy-2,3-dimethyl-1,2,3,4-tetrahydronaphthalen-1-yl]oxy-tert-butyl-dimethylsilane (PubChem CID 53474899) has the molecular formula C27H38O5Si and a molecular weight of 470.68 g/mol. Its IUPAC name is [(1R,2R,3S,4R)-4-(1,3-benzodioxol-5-yl)-6,7-dimethoxy-2,3-dimethyl-1,2,3,4-tetrahydronaphthalen-1-yl]oxy-tert-butyl-dimethylsilane.
| Compound Name | [(1R,2R,3S,4R)-4-(1,3-benzodioxol-5-yl)-6,7-dimethoxy-2,3-dimethyl-1,2,3,4-tetrahydronaphthalen-1-yl]oxy-tert-butyl-dimethylsilane |
|---|---|
| PubChem CID | 53474899 |
| Molecular Formula | C27H38O5Si |
| Molecular Weight | 470.68 g/mol |
| Exact Mass | 470.25 |
| IUPAC Name | [(1R,2R,3S,4R)-4-(1,3-benzodioxol-5-yl)-6,7-dimethoxy-2,3-dimethyl-1,2,3,4-tetrahydronaphthalen-1-yl]oxy-tert-butyl-dimethylsilane |
| SMILES | COc1cc2c(cc1OC)[C@H](O[Si](C)(C)C(C)(C)C)[C@H](C)[C@@H](C)[C@@H]2c1ccc2c(c1)OCO2 |
| InChI | InChI=1S/C27H38O5Si/c1-16-17(2)26(32-33(8,9)27(3,4)5)20-14-23(29-7)22(28-6)13-19(20)25(16)18-10-11-21-24(12-18)31-15-30-21/h10-14,16-17,25-26H,15H2,1-9H3/t16-,17-,25-,26-/m1/s1 |
| InChIKey | ABNJSNDMFFMUCW-XBGJBJTKSA-N |
| XLogP | 6.91 |
| TPSA | 46.15 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 470.68 |
| LogP ≤ 5 | 6.91 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|