C31H44O8Si — CID 71658829
tert-butyl (5R,6R)-8-[tert-butyl(dimethyl)silyl]oxy-5-(3,4,5-trimethoxyphenyl)-5,6,7,8-tetrahydrobenzo[f][1,3]benzodioxole-6-carboxylate (PubChem CID 71658829) has the molecular formula C31H44O8Si and a molecular weight of 572.77 g/mol. Its IUPAC name is tert-butyl (5R,6R)-8-[tert-butyl(dimethyl)silyl]oxy-5-(3,4,5-trimethoxyphenyl)-5,6,7,8-tetrahydrobenzo[f][1,3]benzodioxole-6-carboxylate.
| Compound Name | tert-butyl (5R,6R)-8-[tert-butyl(dimethyl)silyl]oxy-5-(3,4,5-trimethoxyphenyl)-5,6,7,8-tetrahydrobenzo[f][1,3]benzodioxole-6-carboxylate |
|---|---|
| PubChem CID | 71658829 |
| Molecular Formula | C31H44O8Si |
| Molecular Weight | 572.77 g/mol |
| Exact Mass | 572.28 |
| IUPAC Name | tert-butyl (5R,6R)-8-[tert-butyl(dimethyl)silyl]oxy-5-(3,4,5-trimethoxyphenyl)-5,6,7,8-tetrahydrobenzo[f][1,3]benzodioxole-6-carboxylate |
| SMILES | COc1cc([C@@H]2c3cc4c(cc3C(O[Si](C)(C)C(C)(C)C)C[C@H]2C(=O)OC(C)(C)C)OCO4)cc(OC)c1OC |
| InChI | InChI=1S/C31H44O8Si/c1-30(2,3)38-29(32)21-16-22(39-40(10,11)31(4,5)6)19-14-23-24(37-17-36-23)15-20(19)27(21)18-12-25(33-7)28(35-9)26(13-18)34-8/h12-15,21-22,27H,16-17H2,1-11H3/t21-,22?,27-/m1/s1 |
| InChIKey | BYURPOJNYAVPET-ZJLZUVONSA-N |
| XLogP | 7.00 |
| TPSA | 81.68 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 572.77 |
| LogP ≤ 5 | 7.00 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|