C31H41NO10Si — CID 11204320
2-methoxyethyl N-[(5S,5aS,8aR,9R)-9-[4-[tert-butyl(dimethyl)silyl]oxy-3,5-dimethoxyphenyl]-8-oxo-5a,6,8a,9-tetrahydro-5H-[2]benzofuro[5,6-f][1,3]benzodioxol-5-yl]carbamate (PubChem CID 11204320) has the molecular formula C31H41NO10Si and a molecular weight of 615.75 g/mol. Its IUPAC name is 2-methoxyethyl N-[(5S,5aS,8aR,9R)-9-[4-[tert-butyl(dimethyl)silyl]oxy-3,5-dimethoxyphenyl]-8-oxo-5a,6,8a,9-tetrahydro-5H-[2]benzofuro[5,6-f][1,3]benzodioxol-5-yl]carbamate.
| Compound Name | 2-methoxyethyl N-[(5S,5aS,8aR,9R)-9-[4-[tert-butyl(dimethyl)silyl]oxy-3,5-dimethoxyphenyl]-8-oxo-5a,6,8a,9-tetrahydro-5H-[2]benzofuro[5,6-f][1,3]benzodioxol-5-yl]carbamate |
|---|---|
| PubChem CID | 11204320 |
| Molecular Formula | C31H41NO10Si |
| Molecular Weight | 615.75 g/mol |
| Exact Mass | 615.25 |
| IUPAC Name | 2-methoxyethyl N-[(5S,5aS,8aR,9R)-9-[4-[tert-butyl(dimethyl)silyl]oxy-3,5-dimethoxyphenyl]-8-oxo-5a,6,8a,9-tetrahydro-5H-[2]benzofuro[5,6-f][1,3]benzodioxol-5-yl]carbamate |
| SMILES | COCCOC(=O)N[C@@H]1c2cc3c(cc2[C@@H](c2cc(OC)c(O[Si](C)(C)C(C)(C)C)c(OC)c2)[C@H]2C(=O)OC[C@@H]21)OCO3 |
| InChI | InChI=1S/C31H41NO10Si/c1-31(2,3)43(7,8)42-28-23(36-5)11-17(12-24(28)37-6)25-18-13-21-22(41-16-40-21)14-19(18)27(20-15-39-29(33)26(20)25)32-30(34)38-10-9-35-4/h11-14,20,25-27H,9-10,15-16H2,1-8H3,(H,32,34)/t20-,25+,26-,27+/m0/s1 |
| InChIKey | FLSNTXYCENHKOZ-ULBKPHCJSA-N |
| XLogP | 5.16 |
| TPSA | 120.01 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 615.75 |
| LogP ≤ 5 | 5.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|