C30H28N2O8S — CID 44512200
N-[[(5S,5aS,8aR,9R)-8-oxo-9-(3,4,5-trimethoxyphenyl)-5a,6,8a,9-tetrahydro-5H-[2]benzofuro[5,6-f][1,3]benzodioxol-5-yl]carbamothioyl]benzamide (PubChem CID 44512200) has the molecular formula C30H28N2O8S and a molecular weight of 576.63 g/mol. Its IUPAC name is N-[[(5S,5aS,8aR,9R)-8-oxo-9-(3,4,5-trimethoxyphenyl)-5a,6,8a,9-tetrahydro-5H-[2]benzofuro[5,6-f][1,3]benzodioxol-5-yl]carbamothioyl]benzamide.
| Compound Name | N-[[(5S,5aS,8aR,9R)-8-oxo-9-(3,4,5-trimethoxyphenyl)-5a,6,8a,9-tetrahydro-5H-[2]benzofuro[5,6-f][1,3]benzodioxol-5-yl]carbamothioyl]benzamide |
|---|---|
| PubChem CID | 44512200 |
| Molecular Formula | C30H28N2O8S |
| Molecular Weight | 576.63 g/mol |
| Exact Mass | 576.16 |
| IUPAC Name | N-[[(5S,5aS,8aR,9R)-8-oxo-9-(3,4,5-trimethoxyphenyl)-5a,6,8a,9-tetrahydro-5H-[2]benzofuro[5,6-f][1,3]benzodioxol-5-yl]carbamothioyl]benzamide |
| SMILES | COc1cc([C@@H]2c3cc4c(cc3[C@@H](NC(=S)NC(=O)c3ccccc3)[C@H]3COC(=O)[C@H]23)OCO4)cc(OC)c1OC |
| InChI | InChI=1S/C30H28N2O8S/c1-35-22-9-16(10-23(36-2)27(22)37-3)24-17-11-20-21(40-14-39-20)12-18(17)26(19-13-38-29(34)25(19)24)31-30(41)32-28(33)15-7-5-4-6-8-15/h4-12,19,24-26H,13-14H2,1-3H3,(H2,31,32,33,41)/t19-,24+,25-,26+/m0/s1 |
| InChIKey | LOKKUPBGTSDPRG-QNMIOERPSA-N |
| XLogP | 3.72 |
| TPSA | 113.58 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 41 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 576.63 |
| LogP ≤ 5 | 3.72 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|