C24H24O10 — CID 71712296
[(5R,5aR,8aS,9R)-8-oxo-9-(3,4,5-trimethoxyphenyl)-5a,6,8a,9-tetrahydro-5H-[2]benzofuro[5,6-f][1,3]benzodioxol-5-yl] methyl carbonate (PubChem CID 71712296) has the molecular formula C24H24O10 and a molecular weight of 472.45 g/mol. Its IUPAC name is [(5R,5aR,8aS,9R)-8-oxo-9-(3,4,5-trimethoxyphenyl)-5a,6,8a,9-tetrahydro-5H-[2]benzofuro[5,6-f][1,3]benzodioxol-5-yl] methyl carbonate.
| Compound Name | [(5R,5aR,8aS,9R)-8-oxo-9-(3,4,5-trimethoxyphenyl)-5a,6,8a,9-tetrahydro-5H-[2]benzofuro[5,6-f][1,3]benzodioxol-5-yl] methyl carbonate |
|---|---|
| PubChem CID | 71712296 |
| Molecular Formula | C24H24O10 |
| Molecular Weight | 472.45 g/mol |
| Exact Mass | 472.14 |
| IUPAC Name | [(5R,5aR,8aS,9R)-8-oxo-9-(3,4,5-trimethoxyphenyl)-5a,6,8a,9-tetrahydro-5H-[2]benzofuro[5,6-f][1,3]benzodioxol-5-yl] methyl carbonate |
| SMILES | COC(=O)O[C@H]1c2cc3c(cc2[C@@H](c2cc(OC)c(OC)c(OC)c2)[C@@H]2C(=O)OC[C@@H]21)OCO3 |
| InChI | InChI=1S/C24H24O10/c1-27-17-5-11(6-18(28-2)22(17)29-3)19-12-7-15-16(33-10-32-15)8-13(12)21(34-24(26)30-4)14-9-31-23(25)20(14)19/h5-8,14,19-21H,9-10H2,1-4H3/t14-,19+,20+,21-/m0/s1 |
| InChIKey | LHBIPYXBFKZOKF-DJJZHVJBSA-N |
| XLogP | 3.20 |
| TPSA | 107.98 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 472.45 |
| LogP ≤ 5 | 3.20 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 10 |