C28H25NO9 — CID 71819030
[(5R,5aR,8aR,9R)-8-oxo-9-(3,4,5-trimethoxyphenyl)-5a,6,8a,9-tetrahydro-5H-[2]benzofuro[5,6-f][1,3]benzodioxol-5-yl] pyridine-3-carboxylate (PubChem CID 71819030) has the molecular formula C28H25NO9 and a molecular weight of 519.51 g/mol. Its IUPAC name is [(5R,5aR,8aR,9R)-8-oxo-9-(3,4,5-trimethoxyphenyl)-5a,6,8a,9-tetrahydro-5H-[2]benzofuro[5,6-f][1,3]benzodioxol-5-yl] pyridine-3-carboxylate.
| Compound Name | [(5R,5aR,8aR,9R)-8-oxo-9-(3,4,5-trimethoxyphenyl)-5a,6,8a,9-tetrahydro-5H-[2]benzofuro[5,6-f][1,3]benzodioxol-5-yl] pyridine-3-carboxylate |
|---|---|
| PubChem CID | 71819030 |
| Molecular Formula | C28H25NO9 |
| Molecular Weight | 519.51 g/mol |
| Exact Mass | 519.15 |
| IUPAC Name | [(5R,5aR,8aR,9R)-8-oxo-9-(3,4,5-trimethoxyphenyl)-5a,6,8a,9-tetrahydro-5H-[2]benzofuro[5,6-f][1,3]benzodioxol-5-yl] pyridine-3-carboxylate |
| SMILES | COc1cc([C@@H]2c3cc4c(cc3[C@H](OC(=O)c3cccnc3)[C@H]3COC(=O)[C@H]23)OCO4)cc(OC)c1OC |
| InChI | InChI=1S/C28H25NO9/c1-32-21-7-15(8-22(33-2)26(21)34-3)23-16-9-19-20(37-13-36-19)10-17(16)25(18-12-35-28(31)24(18)23)38-27(30)14-5-4-6-29-11-14/h4-11,18,23-25H,12-13H2,1-3H3/t18-,23+,24-,25-/m0/s1 |
| InChIKey | ORDAKZRIAPKUJA-PVUOONDNSA-N |
| XLogP | 3.67 |
| TPSA | 111.64 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 519.51 |
| LogP ≤ 5 | 3.67 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 10 |