C33H29NO11 — CID 127051812
[(5R,5aR,8aR)-8-oxo-9-(3,4,5-trimethoxyphenyl)-5a,6,8a,9-tetrahydro-5H-[2]benzofuro[5,6-f][1,3]benzodioxol-5-yl] 2-(1,3-dioxoisoindol-2-yl)propanoate (PubChem CID 127051812) has the molecular formula C33H29NO11 and a molecular weight of 615.59 g/mol. Its IUPAC name is [(5R,5aR,8aR)-8-oxo-9-(3,4,5-trimethoxyphenyl)-5a,6,8a,9-tetrahydro-5H-[2]benzofuro[5,6-f][1,3]benzodioxol-5-yl] 2-(1,3-dioxoisoindol-2-yl)propanoate.
| Compound Name | [(5R,5aR,8aR)-8-oxo-9-(3,4,5-trimethoxyphenyl)-5a,6,8a,9-tetrahydro-5H-[2]benzofuro[5,6-f][1,3]benzodioxol-5-yl] 2-(1,3-dioxoisoindol-2-yl)propanoate |
|---|---|
| PubChem CID | 127051812 |
| Molecular Formula | C33H29NO11 |
| Molecular Weight | 615.59 g/mol |
| Exact Mass | 615.17 |
| IUPAC Name | [(5R,5aR,8aR)-8-oxo-9-(3,4,5-trimethoxyphenyl)-5a,6,8a,9-tetrahydro-5H-[2]benzofuro[5,6-f][1,3]benzodioxol-5-yl] 2-(1,3-dioxoisoindol-2-yl)propanoate |
| SMILES | COc1cc(C2c3cc4c(cc3[C@H](OC(=O)C(C)N3C(=O)c5ccccc5C3=O)[C@H]3COC(=O)[C@H]23)OCO4)cc(OC)c1OC |
| InChI | InChI=1S/C33H29NO11/c1-15(34-30(35)17-7-5-6-8-18(17)31(34)36)32(37)45-28-20-12-23-22(43-14-44-23)11-19(20)26(27-21(28)13-42-33(27)38)16-9-24(39-2)29(41-4)25(10-16)40-3/h5-12,15,21,26-28H,13-14H2,1-4H3/t15?,21-,26?,27-,28-/m0/s1 |
| InChIKey | DFMXBOMSFHEUPS-KGJITBLZSA-N |
| XLogP | 3.64 |
| TPSA | 136.13 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 615.59 |
| LogP ≤ 5 | 3.64 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|