C29H25NO11 — CID 45033636
[(5R,5aR,8aR,9R)-8-oxo-9-(3,4,5-trimethoxyphenyl)-5a,6,8a,9-tetrahydro-5H-[2]benzofuro[5,6-f][1,3]benzodioxol-5-yl] 4-nitrobenzoate (PubChem CID 45033636) has the molecular formula C29H25NO11 and a molecular weight of 563.52 g/mol. Its IUPAC name is [(5R,5aR,8aR,9R)-8-oxo-9-(3,4,5-trimethoxyphenyl)-5a,6,8a,9-tetrahydro-5H-[2]benzofuro[5,6-f][1,3]benzodioxol-5-yl] 4-nitrobenzoate.
| Compound Name | [(5R,5aR,8aR,9R)-8-oxo-9-(3,4,5-trimethoxyphenyl)-5a,6,8a,9-tetrahydro-5H-[2]benzofuro[5,6-f][1,3]benzodioxol-5-yl] 4-nitrobenzoate |
|---|---|
| PubChem CID | 45033636 |
| Molecular Formula | C29H25NO11 |
| Molecular Weight | 563.52 g/mol |
| Exact Mass | 563.14 |
| IUPAC Name | [(5R,5aR,8aR,9R)-8-oxo-9-(3,4,5-trimethoxyphenyl)-5a,6,8a,9-tetrahydro-5H-[2]benzofuro[5,6-f][1,3]benzodioxol-5-yl] 4-nitrobenzoate |
| SMILES | COc1cc([C@@H]2c3cc4c(cc3[C@H](OC(=O)c3ccc([N+](=O)[O-])cc3)[C@H]3COC(=O)[C@H]23)OCO4)cc(OC)c1OC |
| InChI | InChI=1S/C29H25NO11/c1-35-22-8-15(9-23(36-2)27(22)37-3)24-17-10-20-21(40-13-39-20)11-18(17)26(19-12-38-29(32)25(19)24)41-28(31)14-4-6-16(7-5-14)30(33)34/h4-11,19,24-26H,12-13H2,1-3H3/t19-,24+,25-,26-/m0/s1 |
| InChIKey | HJAZXCVFEYGDKG-JYVYKJRCSA-N |
| XLogP | 4.18 |
| TPSA | 141.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 563.52 |
| LogP ≤ 5 | 4.18 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|