C31H32O9 — CID 71541415
[(3aR,4R,9R,9aR)-6,7-dimethoxy-1-oxo-9-(3,4,5-trimethoxyphenyl)-3a,4,9,9a-tetrahydro-3H-benzo[f][2]benzofuran-4-yl] 4-methylbenzoate (PubChem CID 71541415) has the molecular formula C31H32O9 and a molecular weight of 548.59 g/mol. Its IUPAC name is [(3aR,4R,9R,9aR)-6,7-dimethoxy-1-oxo-9-(3,4,5-trimethoxyphenyl)-3a,4,9,9a-tetrahydro-3H-benzo[f][2]benzofuran-4-yl] 4-methylbenzoate.
| Compound Name | [(3aR,4R,9R,9aR)-6,7-dimethoxy-1-oxo-9-(3,4,5-trimethoxyphenyl)-3a,4,9,9a-tetrahydro-3H-benzo[f][2]benzofuran-4-yl] 4-methylbenzoate |
|---|---|
| PubChem CID | 71541415 |
| Molecular Formula | C31H32O9 |
| Molecular Weight | 548.59 g/mol |
| Exact Mass | 548.20 |
| IUPAC Name | [(3aR,4R,9R,9aR)-6,7-dimethoxy-1-oxo-9-(3,4,5-trimethoxyphenyl)-3a,4,9,9a-tetrahydro-3H-benzo[f][2]benzofuran-4-yl] 4-methylbenzoate |
| SMILES | COc1cc2c(cc1OC)[C@H](OC(=O)c1ccc(C)cc1)[C@H]1COC(=O)[C@@H]1[C@@H]2c1cc(OC)c(OC)c(OC)c1 |
| InChI | InChI=1S/C31H32O9/c1-16-7-9-17(10-8-16)30(32)40-28-20-14-23(35-3)22(34-2)13-19(20)26(27-21(28)15-39-31(27)33)18-11-24(36-4)29(38-6)25(12-18)37-5/h7-14,21,26-28H,15H2,1-6H3/t21-,26+,27-,28-/m0/s1 |
| InChIKey | ZLXJDJZUDGZVFB-RGVCCXDYSA-N |
| XLogP | 4.87 |
| TPSA | 98.75 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 40 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 548.59 |
| LogP ≤ 5 | 4.87 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |