C28H30O14 — CID 22819965
[(5R,5aR,8aR,9R)-8-oxo-9-(3,4,5-trimethoxyphenyl)-5a,6,8a,9-tetrahydro-5H-[2]benzofuro[5,6-f][1,3]benzodioxol-5-yl] (2S,3S,4S,5R,6R)-3,4,5,6-tetrahydroxyoxane-2-carboxylate (PubChem CID 22819965) has the molecular formula C28H30O14 and a molecular weight of 590.53 g/mol. Its IUPAC name is [(5R,5aR,8aR,9R)-8-oxo-9-(3,4,5-trimethoxyphenyl)-5a,6,8a,9-tetrahydro-5H-[2]benzofuro[5,6-f][1,3]benzodioxol-5-yl] (2S,3S,4S,5R,6R)-3,4,5,6-tetrahydroxyoxane-2-carboxylate.
| Compound Name | [(5R,5aR,8aR,9R)-8-oxo-9-(3,4,5-trimethoxyphenyl)-5a,6,8a,9-tetrahydro-5H-[2]benzofuro[5,6-f][1,3]benzodioxol-5-yl] (2S,3S,4S,5R,6R)-3,4,5,6-tetrahydroxyoxane-2-carboxylate |
|---|---|
| PubChem CID | 22819965 |
| Molecular Formula | C28H30O14 |
| Molecular Weight | 590.53 g/mol |
| Exact Mass | 590.16 |
| IUPAC Name | [(5R,5aR,8aR,9R)-8-oxo-9-(3,4,5-trimethoxyphenyl)-5a,6,8a,9-tetrahydro-5H-[2]benzofuro[5,6-f][1,3]benzodioxol-5-yl] (2S,3S,4S,5R,6R)-3,4,5,6-tetrahydroxyoxane-2-carboxylate |
| SMILES | COc1cc([C@@H]2c3cc4c(cc3[C@H](OC(=O)[C@H]3O[C@@H](O)[C@H](O)[C@@H](O)[C@@H]3O)[C@H]3COC(=O)[C@H]23)OCO4)cc(OC)c1OC |
| InChI | InChI=1S/C28H30O14/c1-35-16-4-10(5-17(36-2)24(16)37-3)18-11-6-14-15(40-9-39-14)7-12(11)23(13-8-38-26(32)19(13)18)41-28(34)25-21(30)20(29)22(31)27(33)42-25/h4-7,13,18-23,25,27,29-31,33H,8-9H2,1-3H3/t13-,18+,19-,20-,21-,22+,23-,25-,27+/m0/s1 |
| InChIKey | DWVFXQUQBXFDRT-IENHWHQWSA-N |
| XLogP | -0.24 |
| TPSA | 188.90 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 14 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 590.53 |
| LogP ≤ 5 | -0.24 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 14 |