C35H43N2O12 — CID 11707381
CID 11707381 (PubChem CID 11707381) has the molecular formula C35H43N2O12 and a molecular weight of 683.73 g/mol.
| Compound Name | CID 11707381 |
|---|---|
| PubChem CID | 11707381 |
| Molecular Formula | C35H43N2O12 |
| Molecular Weight | 683.73 g/mol |
| Exact Mass | 683.28 |
| IUPAC Name | — |
| SMILES | COc1cc([C@@H]2c3cc4c(cc3[C@H](OC(=O)[C@H](C)NC(=O)OC3CC(C)(C)N([O])C(C)(C)C3)[C@H]3COC(=O)[C@H]23)OCO4)cc(OC)c1OC |
| InChI | InChI=1S/C35H43N2O12/c1-17(36-33(40)48-19-13-34(2,3)37(41)35(4,5)14-19)31(38)49-29-21-12-24-23(46-16-47-24)11-20(21)27(28-22(29)15-45-32(28)39)18-9-25(42-6)30(44-8)26(10-18)43-7/h9-12,17,19,22,27-29H,13-16H2,1-8H3,(H,36,40)/t17-,22-,27+,28-,29-/m0/s1 |
| InChIKey | ZCAYSHZVZXVRKP-WOSDSOPKSA-N |
| XLogP | 4.44 |
| TPSA | 160.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 49 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 683.73 |
| LogP ≤ 5 | 4.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'} |
|---|