C39H35NO11 — CID 71727697
[(5R,5aR,8aS,9R)-8-oxo-9-(3,4,5-trimethoxyphenyl)-5a,6,8a,9-tetrahydro-5H-[2]benzofuro[5,6-f][1,3]benzodioxol-5-yl] 2-(9H-fluoren-9-ylmethoxycarbonylamino)acetate (PubChem CID 71727697) has the molecular formula C39H35NO11 and a molecular weight of 693.71 g/mol. Its IUPAC name is [(5R,5aR,8aS,9R)-8-oxo-9-(3,4,5-trimethoxyphenyl)-5a,6,8a,9-tetrahydro-5H-[2]benzofuro[5,6-f][1,3]benzodioxol-5-yl] 2-(9H-fluoren-9-ylmethoxycarbonylamino)acetate.
| Compound Name | [(5R,5aR,8aS,9R)-8-oxo-9-(3,4,5-trimethoxyphenyl)-5a,6,8a,9-tetrahydro-5H-[2]benzofuro[5,6-f][1,3]benzodioxol-5-yl] 2-(9H-fluoren-9-ylmethoxycarbonylamino)acetate |
|---|---|
| PubChem CID | 71727697 |
| Molecular Formula | C39H35NO11 |
| Molecular Weight | 693.71 g/mol |
| Exact Mass | 693.22 |
| IUPAC Name | [(5R,5aR,8aS,9R)-8-oxo-9-(3,4,5-trimethoxyphenyl)-5a,6,8a,9-tetrahydro-5H-[2]benzofuro[5,6-f][1,3]benzodioxol-5-yl] 2-(9H-fluoren-9-ylmethoxycarbonylamino)acetate |
| SMILES | COc1cc([C@@H]2c3cc4c(cc3[C@H](OC(=O)CNC(=O)OCC3c5ccccc5-c5ccccc53)[C@H]3COC(=O)[C@@H]23)OCO4)cc(OC)c1OC |
| InChI | InChI=1S/C39H35NO11/c1-44-31-12-20(13-32(45-2)37(31)46-3)34-25-14-29-30(50-19-49-29)15-26(25)36(28-18-47-38(42)35(28)34)51-33(41)16-40-39(43)48-17-27-23-10-6-4-8-21(23)22-9-5-7-11-24(22)27/h4-15,27-28,34-36H,16-19H2,1-3H3,(H,40,43)/t28-,34+,35+,36-/m0/s1 |
| InChIKey | GZYAOYSLZPNNGX-OQXPXOCRSA-N |
| XLogP | 5.50 |
| TPSA | 137.08 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 51 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 693.71 |
| LogP ≤ 5 | 5.50 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'} |
|---|