C37H39NO11 — CID 44545179
1-O-butyl 3-O-[8-oxo-9-(3,4,5-trimethoxyphenyl)-5a,6,8a,9-tetrahydro-5H-[2]benzofuro[5,6-f][1,3]benzodioxol-5-yl] 1,2,3,4-tetrahydroisoquinoline-1,3-dicarboxylate (PubChem CID 44545179) has the molecular formula C37H39NO11 and a molecular weight of 673.72 g/mol. Its IUPAC name is 1-O-butyl 3-O-[8-oxo-9-(3,4,5-trimethoxyphenyl)-5a,6,8a,9-tetrahydro-5H-[2]benzofuro[5,6-f][1,3]benzodioxol-5-yl] 1,2,3,4-tetrahydroisoquinoline-1,3-dicarboxylate.
| Compound Name | 1-O-butyl 3-O-[8-oxo-9-(3,4,5-trimethoxyphenyl)-5a,6,8a,9-tetrahydro-5H-[2]benzofuro[5,6-f][1,3]benzodioxol-5-yl] 1,2,3,4-tetrahydroisoquinoline-1,3-dicarboxylate |
|---|---|
| PubChem CID | 44545179 |
| Molecular Formula | C37H39NO11 |
| Molecular Weight | 673.72 g/mol |
| Exact Mass | 673.25 |
| IUPAC Name | 1-O-butyl 3-O-[8-oxo-9-(3,4,5-trimethoxyphenyl)-5a,6,8a,9-tetrahydro-5H-[2]benzofuro[5,6-f][1,3]benzodioxol-5-yl] 1,2,3,4-tetrahydroisoquinoline-1,3-dicarboxylate |
| SMILES | CCCCOC(=O)C1NC(C(=O)OC2c3cc4c(cc3C(c3cc(OC)c(OC)c(OC)c3)C3C(=O)OCC23)OCO4)Cc2ccccc21 |
| InChI | InChI=1S/C37H39NO11/c1-5-6-11-45-37(41)32-21-10-8-7-9-19(21)12-25(38-32)35(39)49-33-23-16-27-26(47-18-48-27)15-22(23)30(31-24(33)17-46-36(31)40)20-13-28(42-2)34(44-4)29(14-20)43-3/h7-10,13-16,24-25,30-33,38H,5-6,11-12,17-18H2,1-4H3 |
| InChIKey | BHCYZDWMPCEMFL-UHFFFAOYSA-N |
| XLogP | 4.56 |
| TPSA | 137.08 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 49 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 673.72 |
| LogP ≤ 5 | 4.56 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|