C25H26O8 — CID 10813588
(5aR,8aR,9R)-5-prop-2-enoxy-9-(3,4,5-trimethoxyphenyl)-5a,6,8a,9-tetrahydro-5H-[2]benzofuro[5,6-f][1,3]benzodioxol-8-one (PubChem CID 10813588) has the molecular formula C25H26O8 and a molecular weight of 454.48 g/mol. Its IUPAC name is (5aR,8aR,9R)-5-prop-2-enoxy-9-(3,4,5-trimethoxyphenyl)-5a,6,8a,9-tetrahydro-5H-[2]benzofuro[5,6-f][1,3]benzodioxol-8-one.
| Compound Name | (5aR,8aR,9R)-5-prop-2-enoxy-9-(3,4,5-trimethoxyphenyl)-5a,6,8a,9-tetrahydro-5H-[2]benzofuro[5,6-f][1,3]benzodioxol-8-one |
|---|---|
| PubChem CID | 10813588 |
| Molecular Formula | C25H26O8 |
| Molecular Weight | 454.48 g/mol |
| Exact Mass | 454.16 |
| IUPAC Name | (5aR,8aR,9R)-5-prop-2-enoxy-9-(3,4,5-trimethoxyphenyl)-5a,6,8a,9-tetrahydro-5H-[2]benzofuro[5,6-f][1,3]benzodioxol-8-one |
| SMILES | C=CCOC1c2cc3c(cc2[C@@H](c2cc(OC)c(OC)c(OC)c2)[C@H]2C(=O)OC[C@H]12)OCO3 |
| InChI | InChI=1S/C25H26O8/c1-5-6-30-23-15-10-18-17(32-12-33-18)9-14(15)21(22-16(23)11-31-25(22)26)13-7-19(27-2)24(29-4)20(8-13)28-3/h5,7-10,16,21-23H,1,6,11-12H2,2-4H3/t16-,21+,22-,23?/m0/s1 |
| InChIKey | XZNRNRRUPZNDBO-BUJLEBDRSA-N |
| XLogP | 3.62 |
| TPSA | 81.68 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 454.48 |
| LogP ≤ 5 | 3.62 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|