C22H21N3O7 — CID 11091438
(5S,5aS,9R)-5-azido-9-(3,4,5-trimethoxyphenyl)-5a,6,8a,9-tetrahydro-5H-[2]benzofuro[5,6-f][1,3]benzodioxol-8-one (PubChem CID 11091438) has the molecular formula C22H21N3O7 and a molecular weight of 439.42 g/mol. Its IUPAC name is (5S,5aS,9R)-5-azido-9-(3,4,5-trimethoxyphenyl)-5a,6,8a,9-tetrahydro-5H-[2]benzofuro[5,6-f][1,3]benzodioxol-8-one.
| Compound Name | (5S,5aS,9R)-5-azido-9-(3,4,5-trimethoxyphenyl)-5a,6,8a,9-tetrahydro-5H-[2]benzofuro[5,6-f][1,3]benzodioxol-8-one |
|---|---|
| PubChem CID | 11091438 |
| Molecular Formula | C22H21N3O7 |
| Molecular Weight | 439.42 g/mol |
| Exact Mass | 439.14 |
| IUPAC Name | (5S,5aS,9R)-5-azido-9-(3,4,5-trimethoxyphenyl)-5a,6,8a,9-tetrahydro-5H-[2]benzofuro[5,6-f][1,3]benzodioxol-8-one |
| SMILES | COc1cc([C@@H]2c3cc4c(cc3[C@@H](N=[N+]=[N-])[C@H]3COC(=O)C23)OCO4)cc(OC)c1OC |
| InChI | InChI=1S/C22H21N3O7/c1-27-16-4-10(5-17(28-2)21(16)29-3)18-11-6-14-15(32-9-31-14)7-12(11)20(24-25-23)13-8-30-22(26)19(13)18/h4-7,13,18-20H,8-9H2,1-3H3/t13-,18+,19?,20+/m0/s1 |
| InChIKey | UDISTNUOVQRQFK-HURSICKPSA-N |
| XLogP | 3.73 |
| TPSA | 121.21 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 439.42 |
| LogP ≤ 5 | 3.73 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|