C33H48O8Si2 — CID 11764584
(5aR,8aR,9R)-4-[tert-butyl(dimethyl)silyl]oxy-9-[4-[tert-butyl(dimethyl)silyl]oxy-3,5-dimethoxyphenyl]-5a,6,8a,9-tetrahydro-5H-[2]benzofuro[6,5-f][1,3]benzodioxol-8-one (PubChem CID 11764584) has the molecular formula C33H48O8Si2 and a molecular weight of 628.91 g/mol. Its IUPAC name is (5aR,8aR,9R)-4-[tert-butyl(dimethyl)silyl]oxy-9-[4-[tert-butyl(dimethyl)silyl]oxy-3,5-dimethoxyphenyl]-5a,6,8a,9-tetrahydro-5H-[2]benzofuro[6,5-f][1,3]benzodioxol-8-one.
| Compound Name | (5aR,8aR,9R)-4-[tert-butyl(dimethyl)silyl]oxy-9-[4-[tert-butyl(dimethyl)silyl]oxy-3,5-dimethoxyphenyl]-5a,6,8a,9-tetrahydro-5H-[2]benzofuro[6,5-f][1,3]benzodioxol-8-one |
|---|---|
| PubChem CID | 11764584 |
| Molecular Formula | C33H48O8Si2 |
| Molecular Weight | 628.91 g/mol |
| Exact Mass | 628.29 |
| IUPAC Name | (5aR,8aR,9R)-4-[tert-butyl(dimethyl)silyl]oxy-9-[4-[tert-butyl(dimethyl)silyl]oxy-3,5-dimethoxyphenyl]-5a,6,8a,9-tetrahydro-5H-[2]benzofuro[6,5-f][1,3]benzodioxol-8-one |
| SMILES | COc1cc([C@@H]2c3cc4c(c(O[Si](C)(C)C(C)(C)C)c3C[C@H]3COC(=O)[C@@H]32)OCO4)cc(OC)c1O[Si](C)(C)C(C)(C)C |
| InChI | InChI=1S/C33H48O8Si2/c1-32(2,3)42(9,10)40-28-22-13-20-17-37-31(34)27(20)26(21(22)16-25-30(28)39-18-38-25)19-14-23(35-7)29(24(15-19)36-8)41-43(11,12)33(4,5)6/h14-16,20,26-27H,13,17-18H2,1-12H3/t20-,26+,27-/m0/s1 |
| InChIKey | CADYMPAWLIITAP-BAURHKQJSA-N |
| XLogP | 7.68 |
| TPSA | 81.68 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 628.91 |
| LogP ≤ 5 | 7.68 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|