C41H56O8 — CID 10146529
[4-[(5R,5aR,8aR)-6-oxo-5a,8,8a,9-tetrahydro-5H-[2]benzofuro[6,5-f][1,3]benzodioxol-5-yl]-2,6-dimethoxyphenyl] (E)-icos-11-enoate (PubChem CID 10146529) has the molecular formula C41H56O8 and a molecular weight of 676.89 g/mol. Its IUPAC name is [4-[(5R,5aR,8aR)-6-oxo-5a,8,8a,9-tetrahydro-5H-[2]benzofuro[6,5-f][1,3]benzodioxol-5-yl]-2,6-dimethoxyphenyl] (E)-icos-11-enoate.
| Compound Name | [4-[(5R,5aR,8aR)-6-oxo-5a,8,8a,9-tetrahydro-5H-[2]benzofuro[6,5-f][1,3]benzodioxol-5-yl]-2,6-dimethoxyphenyl] (E)-icos-11-enoate |
|---|---|
| PubChem CID | 10146529 |
| Molecular Formula | C41H56O8 |
| Molecular Weight | 676.89 g/mol |
| Exact Mass | 676.40 |
| IUPAC Name | [4-[(5R,5aR,8aR)-6-oxo-5a,8,8a,9-tetrahydro-5H-[2]benzofuro[6,5-f][1,3]benzodioxol-5-yl]-2,6-dimethoxyphenyl] (E)-icos-11-enoate |
| SMILES | CCCCCCCC/C=C/CCCCCCCCCC(=O)Oc1c(OC)cc([C@@H]2c3cc4c(cc3C[C@H]3COC(=O)[C@@H]32)OCO4)cc1OC |
| InChI | InChI=1S/C41H56O8/c1-4-5-6-7-8-9-10-11-12-13-14-15-16-17-18-19-20-21-37(42)49-40-35(44-2)24-30(25-36(40)45-3)38-32-26-34-33(47-28-48-34)23-29(32)22-31-27-46-41(43)39(31)38/h11-12,23-26,31,38-39H,4-10,13-22,27-28H2,1-3H3/b12-11+/t31-,38+,39-/m0/s1 |
| InChIKey | WUBJAMFPQIVGQK-QPVISQTKSA-N |
| XLogP | 9.63 |
| TPSA | 89.52 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 21 |
| Heavy Atoms | 49 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 676.89 |
| LogP ≤ 5 | 9.63 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|