C23H26O7 — CID 154706886
(5R,5aS,6R,8aR)-6-methoxy-5-(3,4,5-trimethoxyphenyl)-5,5a,6,8,8a,9-hexahydro-[2]benzofuro[5,6-f][1,3]benzodioxole (PubChem CID 154706886) has the molecular formula C23H26O7 and a molecular weight of 414.45 g/mol. Its IUPAC name is (5R,5aS,6R,8aR)-6-methoxy-5-(3,4,5-trimethoxyphenyl)-5,5a,6,8,8a,9-hexahydro-[2]benzofuro[5,6-f][1,3]benzodioxole.
| Compound Name | (5R,5aS,6R,8aR)-6-methoxy-5-(3,4,5-trimethoxyphenyl)-5,5a,6,8,8a,9-hexahydro-[2]benzofuro[5,6-f][1,3]benzodioxole |
|---|---|
| PubChem CID | 154706886 |
| Molecular Formula | C23H26O7 |
| Molecular Weight | 414.45 g/mol |
| Exact Mass | 414.17 |
| IUPAC Name | (5R,5aS,6R,8aR)-6-methoxy-5-(3,4,5-trimethoxyphenyl)-5,5a,6,8,8a,9-hexahydro-[2]benzofuro[5,6-f][1,3]benzodioxole |
| SMILES | COc1cc([C@@H]2c3cc4c(cc3C[C@H]3CO[C@@H](OC)[C@H]32)OCO4)cc(OC)c1OC |
| InChI | InChI=1S/C23H26O7/c1-24-18-7-13(8-19(25-2)22(18)26-3)20-15-9-17-16(29-11-30-17)6-12(15)5-14-10-28-23(27-4)21(14)20/h6-9,14,20-21,23H,5,10-11H2,1-4H3/t14-,20+,21+,23+/m0/s1 |
| InChIKey | HLRRZIJTAGQQNC-JFFTYCRQSA-N |
| XLogP | 3.36 |
| TPSA | 64.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 414.45 |
| LogP ≤ 5 | 3.36 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |