C22H24O5S — CID 90672205
(5S,5aR,8aR)-5-(3,4,5-trimethoxyphenyl)-5,5a,6,8,8a,9-hexahydro-[2]benzothiolo[5,6-f][1,3]benzodioxole (PubChem CID 90672205) has the molecular formula C22H24O5S and a molecular weight of 400.50 g/mol. Its IUPAC name is (5S,5aR,8aR)-5-(3,4,5-trimethoxyphenyl)-5,5a,6,8,8a,9-hexahydro-[2]benzothiolo[5,6-f][1,3]benzodioxole.
| Compound Name | (5S,5aR,8aR)-5-(3,4,5-trimethoxyphenyl)-5,5a,6,8,8a,9-hexahydro-[2]benzothiolo[5,6-f][1,3]benzodioxole |
|---|---|
| PubChem CID | 90672205 |
| Molecular Formula | C22H24O5S |
| Molecular Weight | 400.50 g/mol |
| Exact Mass | 400.13 |
| IUPAC Name | (5S,5aR,8aR)-5-(3,4,5-trimethoxyphenyl)-5,5a,6,8,8a,9-hexahydro-[2]benzothiolo[5,6-f][1,3]benzodioxole |
| SMILES | COc1cc([C@H]2c3cc4c(cc3C[C@H]3CSC[C@@H]32)OCO4)cc(OC)c1OC |
| InChI | InChI=1S/C22H24O5S/c1-23-19-6-13(7-20(24-2)22(19)25-3)21-15-8-18-17(26-11-27-18)5-12(15)4-14-9-28-10-16(14)21/h5-8,14,16,21H,4,9-11H2,1-3H3/t14-,16-,21-/m0/s1 |
| InChIKey | CBRABOXRKNQHCU-HTZUNMPGSA-N |
| XLogP | 4.11 |
| TPSA | 46.15 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 400.50 |
| LogP ≤ 5 | 4.11 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |