C24H24O8S — CID 44575860
[(5S,5aS,8aR,9R)-8-oxo-9-(3,4,5-trimethoxyphenyl)-5a,6,8a,9-tetrahydro-5H-[2]benzothiolo[6,5-f][1,3]benzodioxol-5-yl] acetate (PubChem CID 44575860) has the molecular formula C24H24O8S and a molecular weight of 472.52 g/mol. Its IUPAC name is [(5S,5aS,8aR,9R)-8-oxo-9-(3,4,5-trimethoxyphenyl)-5a,6,8a,9-tetrahydro-5H-[2]benzothiolo[6,5-f][1,3]benzodioxol-5-yl] acetate.
| Compound Name | [(5S,5aS,8aR,9R)-8-oxo-9-(3,4,5-trimethoxyphenyl)-5a,6,8a,9-tetrahydro-5H-[2]benzothiolo[6,5-f][1,3]benzodioxol-5-yl] acetate |
|---|---|
| PubChem CID | 44575860 |
| Molecular Formula | C24H24O8S |
| Molecular Weight | 472.52 g/mol |
| Exact Mass | 472.12 |
| IUPAC Name | [(5S,5aS,8aR,9R)-8-oxo-9-(3,4,5-trimethoxyphenyl)-5a,6,8a,9-tetrahydro-5H-[2]benzothiolo[6,5-f][1,3]benzodioxol-5-yl] acetate |
| SMILES | COc1cc([C@@H]2c3cc4c(cc3[C@@H](OC(C)=O)[C@H]3CSC(=O)[C@H]23)OCO4)cc(OC)c1OC |
| InChI | InChI=1S/C24H24O8S/c1-11(25)32-22-14-8-17-16(30-10-31-17)7-13(14)20(21-15(22)9-33-24(21)26)12-5-18(27-2)23(29-4)19(6-12)28-3/h5-8,15,20-22H,9-10H2,1-4H3/t15-,20+,21-,22+/m0/s1 |
| InChIKey | XXPVQLOKXOEZBD-QWIYEXKTSA-N |
| XLogP | 3.70 |
| TPSA | 89.52 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 472.52 |
| LogP ≤ 5 | 3.70 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|