C21H20O7 — CID 102061567
(9R,13R)-5-hydroxy-3,4-dimethoxy-11,18,20-trioxapentacyclo[13.7.0.02,7.09,13.017,21]docosa-1(22),2,4,6,15,17(21)-hexaen-10-one (PubChem CID 102061567) has the molecular formula C21H20O7 and a molecular weight of 384.38 g/mol. Its IUPAC name is (9R,13R)-5-hydroxy-3,4-dimethoxy-11,18,20-trioxapentacyclo[13.7.0.02,7.09,13.017,21]docosa-1(22),2,4,6,15,17(21)-hexaen-10-one.
| Compound Name | (9R,13R)-5-hydroxy-3,4-dimethoxy-11,18,20-trioxapentacyclo[13.7.0.02,7.09,13.017,21]docosa-1(22),2,4,6,15,17(21)-hexaen-10-one |
|---|---|
| PubChem CID | 102061567 |
| Molecular Formula | C21H20O7 |
| Molecular Weight | 384.38 g/mol |
| Exact Mass | 384.12 |
| IUPAC Name | (9R,13R)-5-hydroxy-3,4-dimethoxy-11,18,20-trioxapentacyclo[13.7.0.02,7.09,13.017,21]docosa-1(22),2,4,6,15,17(21)-hexaen-10-one |
| SMILES | COc1c(O)cc2c(c1OC)-c1cc3c(cc1C[C@H]1COC(=O)[C@@H]1C2)OCO3 |
| InChI | InChI=1S/C21H20O7/c1-24-19-15(22)5-11-4-14-12(8-26-21(14)23)3-10-6-16-17(28-9-27-16)7-13(10)18(11)20(19)25-2/h5-7,12,14,22H,3-4,8-9H2,1-2H3/t12-,14+/m0/s1 |
| InChIKey | AIEHPENBBXMQLX-GXTWGEPZSA-N |
| XLogP | 2.69 |
| TPSA | 83.45 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 384.38 |
| LogP ≤ 5 | 2.69 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |