C24H28O6Si — CID 100971020
(9R,13R)-17,18,19-trimethoxy-4-trimethylsilyl-11-oxatetracyclo[13.4.0.02,7.09,13]nonadeca-1(19),2(7),3,5,15,17-hexaene-8,12-dione (PubChem CID 100971020) has the molecular formula C24H28O6Si and a molecular weight of 440.57 g/mol. Its IUPAC name is (9R,13R)-17,18,19-trimethoxy-4-trimethylsilyl-11-oxatetracyclo[13.4.0.02,7.09,13]nonadeca-1(19),2(7),3,5,15,17-hexaene-8,12-dione.
| Compound Name | (9R,13R)-17,18,19-trimethoxy-4-trimethylsilyl-11-oxatetracyclo[13.4.0.02,7.09,13]nonadeca-1(19),2(7),3,5,15,17-hexaene-8,12-dione |
|---|---|
| PubChem CID | 100971020 |
| Molecular Formula | C24H28O6Si |
| Molecular Weight | 440.57 g/mol |
| Exact Mass | 440.17 |
| IUPAC Name | (9R,13R)-17,18,19-trimethoxy-4-trimethylsilyl-11-oxatetracyclo[13.4.0.02,7.09,13]nonadeca-1(19),2(7),3,5,15,17-hexaene-8,12-dione |
| SMILES | COc1cc2c(c(OC)c1OC)-c1cc([Si](C)(C)C)ccc1C(=O)[C@H]1COC(=O)[C@@H]1C2 |
| InChI | InChI=1S/C24H28O6Si/c1-27-19-10-13-9-17-18(12-30-24(17)26)21(25)15-8-7-14(31(4,5)6)11-16(15)20(13)23(29-3)22(19)28-2/h7-8,10-11,17-18H,9,12H2,1-6H3/t17-,18+/m1/s1 |
| InChIKey | WLLOERVGEKUGEI-MSOLQXFVSA-N |
| XLogP | 3.45 |
| TPSA | 71.06 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 440.57 |
| LogP ≤ 5 | 3.45 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|