C26H36O6Si — CID 11677202
(7R)-7-[tert-butyl(dimethyl)silyl]oxy-1,2,3,9-tetramethoxy-6,7-dihydro-5H-benzo[a]heptalen-10-one (PubChem CID 11677202) has the molecular formula C26H36O6Si and a molecular weight of 472.65 g/mol. Its IUPAC name is (7R)-7-[tert-butyl(dimethyl)silyl]oxy-1,2,3,9-tetramethoxy-6,7-dihydro-5H-benzo[a]heptalen-10-one.
| Compound Name | (7R)-7-[tert-butyl(dimethyl)silyl]oxy-1,2,3,9-tetramethoxy-6,7-dihydro-5H-benzo[a]heptalen-10-one |
|---|---|
| PubChem CID | 11677202 |
| Molecular Formula | C26H36O6Si |
| Molecular Weight | 472.65 g/mol |
| Exact Mass | 472.23 |
| IUPAC Name | (7R)-7-[tert-butyl(dimethyl)silyl]oxy-1,2,3,9-tetramethoxy-6,7-dihydro-5H-benzo[a]heptalen-10-one |
| SMILES | COc1cc2c(c(OC)c1OC)-c1ccc(=O)c(OC)cc1[C@H](O[Si](C)(C)C(C)(C)C)CC2 |
| InChI | InChI=1S/C26H36O6Si/c1-26(2,3)33(8,9)32-20-13-10-16-14-22(29-5)24(30-6)25(31-7)23(16)17-11-12-19(27)21(28-4)15-18(17)20/h11-12,14-15,20H,10,13H2,1-9H3/t20-/m1/s1 |
| InChIKey | RFFYHZRWWIHFGP-HXUWFJFHSA-N |
| XLogP | 5.76 |
| TPSA | 63.22 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 472.65 |
| LogP ≤ 5 | 5.76 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|