C21H21F3N2O5 — CID 634893
N-(10-amino-1,2,3-trimethoxy-9-oxo-6,7-dihydro-5H-benzo[a]heptalen-7-yl)-2,2,2-trifluoroacetamide (PubChem CID 634893) has the molecular formula C21H21F3N2O5 and a molecular weight of 438.40 g/mol. Its IUPAC name is N-(10-amino-1,2,3-trimethoxy-9-oxo-6,7-dihydro-5H-benzo[a]heptalen-7-yl)-2,2,2-trifluoroacetamide.
| Compound Name | N-(10-amino-1,2,3-trimethoxy-9-oxo-6,7-dihydro-5H-benzo[a]heptalen-7-yl)-2,2,2-trifluoroacetamide |
|---|---|
| PubChem CID | 634893 |
| Molecular Formula | C21H21F3N2O5 |
| Molecular Weight | 438.40 g/mol |
| Exact Mass | 438.14 |
| IUPAC Name | N-(10-amino-1,2,3-trimethoxy-9-oxo-6,7-dihydro-5H-benzo[a]heptalen-7-yl)-2,2,2-trifluoroacetamide |
| SMILES | COc1cc2c(c(OC)c1OC)-c1ccc(N)c(=O)cc1C(NC(=O)C(F)(F)F)CC2 |
| InChI | InChI=1S/C21H21F3N2O5/c1-29-16-8-10-4-7-14(26-20(28)21(22,23)24)12-9-15(27)13(25)6-5-11(12)17(10)19(31-3)18(16)30-2/h5-6,8-9,14H,4,7H2,1-3H3,(H2,25,27)(H,26,28) |
| InChIKey | KPUQFELWTOHGSX-UHFFFAOYSA-N |
| XLogP | 2.99 |
| TPSA | 99.88 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 438.40 |
| LogP ≤ 5 | 2.99 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |