C27H26N2O9 — CID 164935840
(4-nitrophenyl) N-[(7S)-1,2,3,10-tetramethoxy-9-oxo-6,7-dihydro-5H-benzo[a]heptalen-7-yl]carbamate (PubChem CID 164935840) has the molecular formula C27H26N2O9 and a molecular weight of 522.51 g/mol. Its IUPAC name is (4-nitrophenyl) N-[(7S)-1,2,3,10-tetramethoxy-9-oxo-6,7-dihydro-5H-benzo[a]heptalen-7-yl]carbamate.
| Compound Name | (4-nitrophenyl) N-[(7S)-1,2,3,10-tetramethoxy-9-oxo-6,7-dihydro-5H-benzo[a]heptalen-7-yl]carbamate |
|---|---|
| PubChem CID | 164935840 |
| Molecular Formula | C27H26N2O9 |
| Molecular Weight | 522.51 g/mol |
| Exact Mass | 522.16 |
| IUPAC Name | (4-nitrophenyl) N-[(7S)-1,2,3,10-tetramethoxy-9-oxo-6,7-dihydro-5H-benzo[a]heptalen-7-yl]carbamate |
| SMILES | COc1cc2c(c(OC)c1OC)-c1ccc(OC)c(=O)cc1[C@@H](NC(=O)Oc1ccc([N+](=O)[O-])cc1)CC2 |
| InChI | InChI=1S/C27H26N2O9/c1-34-22-12-10-18-19(14-21(22)30)20(28-27(31)38-17-8-6-16(7-9-17)29(32)33)11-5-15-13-23(35-2)25(36-3)26(37-4)24(15)18/h6-10,12-14,20H,5,11H2,1-4H3,(H,28,31)/t20-/m0/s1 |
| InChIKey | QKHXLBFNGXFFHZ-FQEVSTJZSA-N |
| XLogP | 4.43 |
| TPSA | 135.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 522.51 |
| LogP ≤ 5 | 4.43 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|