C27H25N3O9S — CID 10745587
3,5-dinitro-N-[(7S)-1,2,3-trimethoxy-10-methylsulfanyl-9-oxo-6,7-dihydro-5H-benzo[a]heptalen-7-yl]benzamide (PubChem CID 10745587) has the molecular formula C27H25N3O9S and a molecular weight of 567.58 g/mol. Its IUPAC name is 3,5-dinitro-N-[(7S)-1,2,3-trimethoxy-10-methylsulfanyl-9-oxo-6,7-dihydro-5H-benzo[a]heptalen-7-yl]benzamide.
| Compound Name | 3,5-dinitro-N-[(7S)-1,2,3-trimethoxy-10-methylsulfanyl-9-oxo-6,7-dihydro-5H-benzo[a]heptalen-7-yl]benzamide |
|---|---|
| PubChem CID | 10745587 |
| Molecular Formula | C27H25N3O9S |
| Molecular Weight | 567.58 g/mol |
| Exact Mass | 567.13 |
| IUPAC Name | 3,5-dinitro-N-[(7S)-1,2,3-trimethoxy-10-methylsulfanyl-9-oxo-6,7-dihydro-5H-benzo[a]heptalen-7-yl]benzamide |
| SMILES | COc1cc2c(c(OC)c1OC)-c1ccc(SC)c(=O)cc1[C@@H](NC(=O)c1cc([N+](=O)[O-])cc([N+](=O)[O-])c1)CC2 |
| InChI | InChI=1S/C27H25N3O9S/c1-37-22-11-14-5-7-20(28-27(32)15-9-16(29(33)34)12-17(10-15)30(35)36)19-13-21(31)23(40-4)8-6-18(19)24(14)26(39-3)25(22)38-2/h6,8-13,20H,5,7H2,1-4H3,(H,28,32)/t20-/m0/s1 |
| InChIKey | GQKFEWTUOZTEHK-FQEVSTJZSA-N |
| XLogP | 4.70 |
| TPSA | 160.14 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 40 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 567.58 |
| LogP ≤ 5 | 4.70 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|