C33H32N2O10S — CID 10556193
[(7S)-10-methylsulfanyl-7-[(4-nitrobenzoyl)amino]-9-oxo-1,2-di(propanoyloxy)-6,7-dihydro-5H-benzo[a]heptalen-3-yl] propanoate (PubChem CID 10556193) has the molecular formula C33H32N2O10S and a molecular weight of 648.69 g/mol. Its IUPAC name is [(7S)-10-methylsulfanyl-7-[(4-nitrobenzoyl)amino]-9-oxo-1,2-di(propanoyloxy)-6,7-dihydro-5H-benzo[a]heptalen-3-yl] propanoate.
| Compound Name | [(7S)-10-methylsulfanyl-7-[(4-nitrobenzoyl)amino]-9-oxo-1,2-di(propanoyloxy)-6,7-dihydro-5H-benzo[a]heptalen-3-yl] propanoate |
|---|---|
| PubChem CID | 10556193 |
| Molecular Formula | C33H32N2O10S |
| Molecular Weight | 648.69 g/mol |
| Exact Mass | 648.18 |
| IUPAC Name | [(7S)-10-methylsulfanyl-7-[(4-nitrobenzoyl)amino]-9-oxo-1,2-di(propanoyloxy)-6,7-dihydro-5H-benzo[a]heptalen-3-yl] propanoate |
| SMILES | CCC(=O)Oc1cc2c(c(OC(=O)CC)c1OC(=O)CC)-c1ccc(SC)c(=O)cc1[C@@H](NC(=O)c1ccc([N+](=O)[O-])cc1)CC2 |
| InChI | InChI=1S/C33H32N2O10S/c1-5-27(37)43-25-16-19-10-14-23(34-33(40)18-8-11-20(12-9-18)35(41)42)22-17-24(36)26(46-4)15-13-21(22)30(19)32(45-29(39)7-3)31(25)44-28(38)6-2/h8-9,11-13,15-17,23H,5-7,10,14H2,1-4H3,(H,34,40)/t23-/m0/s1 |
| InChIKey | UODKABVMCGHFAI-QHCPKHFHSA-N |
| XLogP | 5.71 |
| TPSA | 168.21 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 46 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 648.69 |
| LogP ≤ 5 | 5.71 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|