C25H25NO8S — CID 90902671
4-[[(7S)-7-acetamido-1,2-dimethoxy-10-methylsulfanyl-9-oxo-6,7-dihydro-5H-benzo[a]heptalen-3-yl]oxy]-4-oxobut-2-enoic acid (PubChem CID 90902671) has the molecular formula C25H25NO8S and a molecular weight of 499.54 g/mol. Its IUPAC name is 4-[[(7S)-7-acetamido-1,2-dimethoxy-10-methylsulfanyl-9-oxo-6,7-dihydro-5H-benzo[a]heptalen-3-yl]oxy]-4-oxobut-2-enoic acid.
| Compound Name | 4-[[(7S)-7-acetamido-1,2-dimethoxy-10-methylsulfanyl-9-oxo-6,7-dihydro-5H-benzo[a]heptalen-3-yl]oxy]-4-oxobut-2-enoic acid |
|---|---|
| PubChem CID | 90902671 |
| Molecular Formula | C25H25NO8S |
| Molecular Weight | 499.54 g/mol |
| Exact Mass | 499.13 |
| IUPAC Name | 4-[[(7S)-7-acetamido-1,2-dimethoxy-10-methylsulfanyl-9-oxo-6,7-dihydro-5H-benzo[a]heptalen-3-yl]oxy]-4-oxobut-2-enoic acid |
| SMILES | COc1c(OC(=O)C=CC(=O)O)cc2c(c1OC)-c1ccc(SC)c(=O)cc1[C@@H](NC(C)=O)CC2 |
| InChI | InChI=1S/C25H25NO8S/c1-13(27)26-17-7-5-14-11-19(34-22(31)10-9-21(29)30)24(32-2)25(33-3)23(14)15-6-8-20(35-4)18(28)12-16(15)17/h6,8-12,17H,5,7H2,1-4H3,(H,26,27)(H,29,30)/t17-/m0/s1 |
| InChIKey | FOFJJHOHJCNNHR-KRWDZBQOSA-N |
| XLogP | 3.12 |
| TPSA | 128.23 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 499.54 |
| LogP ≤ 5 | 3.12 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|