C27H31NO7S — CID 88993074
(7-acetamido-1,2-dimethoxy-10-methylsulfanyl-9-oxo-6,7-dihydro-5H-benzo[a]heptalen-3-yl) 4-methoxypent-4-enoate (PubChem CID 88993074) has the molecular formula C27H31NO7S and a molecular weight of 513.61 g/mol. Its IUPAC name is (7-acetamido-1,2-dimethoxy-10-methylsulfanyl-9-oxo-6,7-dihydro-5H-benzo[a]heptalen-3-yl) 4-methoxypent-4-enoate.
| Compound Name | (7-acetamido-1,2-dimethoxy-10-methylsulfanyl-9-oxo-6,7-dihydro-5H-benzo[a]heptalen-3-yl) 4-methoxypent-4-enoate |
|---|---|
| PubChem CID | 88993074 |
| Molecular Formula | C27H31NO7S |
| Molecular Weight | 513.61 g/mol |
| Exact Mass | 513.18 |
| IUPAC Name | (7-acetamido-1,2-dimethoxy-10-methylsulfanyl-9-oxo-6,7-dihydro-5H-benzo[a]heptalen-3-yl) 4-methoxypent-4-enoate |
| SMILES | C=C(CCC(=O)Oc1cc2c(c(OC)c1OC)-c1ccc(SC)c(=O)cc1C(NC(C)=O)CC2)OC |
| InChI | InChI=1S/C27H31NO7S/c1-15(32-3)7-12-24(31)35-22-13-17-8-10-20(28-16(2)29)19-14-21(30)23(36-6)11-9-18(19)25(17)27(34-5)26(22)33-4/h9,11,13-14,20H,1,7-8,10,12H2,2-6H3,(H,28,29) |
| InChIKey | WCVNDIUXMQIQGQ-UHFFFAOYSA-N |
| XLogP | 4.42 |
| TPSA | 100.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 513.61 |
| LogP ≤ 5 | 4.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|