C22H22F3NO7S2 — CID 131887627
[(7S)-7-acetamido-1,2-dimethoxy-10-methylsulfanyl-9-oxo-6,7-dihydro-5H-benzo[a]heptalen-3-yl] trifluoromethanesulfonate (PubChem CID 131887627) has the molecular formula C22H22F3NO7S2 and a molecular weight of 533.55 g/mol. Its IUPAC name is [(7S)-7-acetamido-1,2-dimethoxy-10-methylsulfanyl-9-oxo-6,7-dihydro-5H-benzo[a]heptalen-3-yl] trifluoromethanesulfonate.
| Compound Name | [(7S)-7-acetamido-1,2-dimethoxy-10-methylsulfanyl-9-oxo-6,7-dihydro-5H-benzo[a]heptalen-3-yl] trifluoromethanesulfonate |
|---|---|
| PubChem CID | 131887627 |
| Molecular Formula | C22H22F3NO7S2 |
| Molecular Weight | 533.55 g/mol |
| Exact Mass | 533.08 |
| IUPAC Name | [(7S)-7-acetamido-1,2-dimethoxy-10-methylsulfanyl-9-oxo-6,7-dihydro-5H-benzo[a]heptalen-3-yl] trifluoromethanesulfonate |
| SMILES | COc1c(OS(=O)(=O)C(F)(F)F)cc2c(c1OC)-c1ccc(SC)c(=O)cc1[C@@H](NC(C)=O)CC2 |
| InChI | InChI=1S/C22H22F3NO7S2/c1-11(27)26-15-7-5-12-9-17(33-35(29,30)22(23,24)25)20(31-2)21(32-3)19(12)13-6-8-18(34-4)16(28)10-14(13)15/h6,8-10,15H,5,7H2,1-4H3,(H,26,27)/t15-/m0/s1 |
| InChIKey | LOKZYTVFKGDTRV-HNNXBMFYSA-N |
| XLogP | 3.80 |
| TPSA | 108.00 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 533.55 |
| LogP ≤ 5 | 3.80 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'}, {'alert_name': 'triflate', 'substructure': 'N/A'} |
|---|